Products 1202769-01-4
CAS 1202769-01-4 is the registry number for 2-Bromo-6,7,8,9-tetrahydrocyclohept[b]indol-10(5H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-6,7,8,9-tetrahydro-5H-cyclohepta[b]indol-10-one (CAS 1202769-01-4) is a chemical compound with the molecular formula C13H12BrNO and a molecular weight of 278.14 g/mol. IUPAC name: 2-bromo-6,7,8,9-tetrahydro-5H-cyclohepta[b]indol-10-one. InChIKey: VAKHCPRANHUIRB-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | 2-bromo-6,7,8,9-tetrahydro-5H-cyclohepta[b]indol-10-one |
| InChIKey | VAKHCPRANHUIRB-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C1)NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)