Products 1202864-83-2
CAS 1202864-83-2 appears in our catalog under these names: 2,4-Dichlorophenol-13C6, >95% (GC), 2,4-Dichlorophenol 13C6 100 µg/mL in Acetone. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10mg, 25mg, 5mg, 1ml.
2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 1202864-83-2) is a chemical compound with the molecular formula C6H4Cl2O and a molecular weight of 168.95 g/mol. IUPAC name: 2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: HFZWRUODUSTPEG-IDEBNGHGSA-N.
| Molecular formula | C6H4Cl2O |
|---|---|
| Molecular weight | 168.95 g/mol |
| IUPAC name | 2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | HFZWRUODUSTPEG-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1Cl)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol, 2,4-Dichlorophenol 13C6, 2,4-Dichlorophenol-13C6, 2,4-Dichlorophenol 13C6; 2,4-Dichlorophenol-1,2,3,4,5,6-13C6, 2,4-Dichlorophenol 13C6 100 microg/mL in Acetone, orb2299663, 2,4-Dichloro(~13~C_6_)phenol, 2,4-Dichlorophenol 13C6 100 |Ig/mL in Acetone, 2,4-Dichlorophenol-13C6, 99 atom % 13C, 97% (CP)