Products 93951-74-7
CAS 93951-74-7 appears in our catalog under these names: 2,4-Dichlorophenol-d3, >95% (GC), 2,4-Dichlorophenol D3 (3,5,6 D3), 2,4-Dichlorophenol D3 (3,5,6 D3) 100 µg/mL in Methyl-tert-butyl ether, 2,4-Dichlorophenol-3,5,6-d3, 98 atom % D, min 98% Chemical Purity, 2，4–Dichlorophenol–d3. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 50mg, 5mg, 1ml, 0,5g, 0,1g, 100MG, 1x1ml, 1x50mg.
2,4-dichloro-3,5,6-trideuteriophenol (CAS 93951-74-7) is a chemical compound with the molecular formula C6H4Cl2O and a molecular weight of 166.02 g/mol. IUPAC name: 2,4-dichloro-3,5,6-trideuteriophenol. InChIKey: HFZWRUODUSTPEG-CBYSEHNBSA-N.
| Molecular formula | C6H4Cl2O |
|---|---|
| Molecular weight | 166.02 g/mol |
| IUPAC name | 2,4-dichloro-3,5,6-trideuteriophenol |
| InChIKey | HFZWRUODUSTPEG-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1O)Cl)[2H])Cl)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Phen-2,3,5-d3-ol, 4,6-dichloro-, 2,4-Dichlorophenol-d3, 2,4-Dichlorophenol-3,5,6-d3, 2,4-dichloro-3,5,6-trideuteriophenol, 2,4-Dichlorophenol D3 (3,5,6 D3), dichloro(?H?)phenol, d3-2,4-dichlorophenol, 2,4-Dichlorophenol-3,5,6-d?, 2,4-dichloro-3,5,6-trideuterio-phenol, 2,4-Dichlorophenol-d3, analytical standard