CAS 120293-52-9 is the registry number for Mikimopine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 250mg, 50mg, 5mg, 25mg, 100mg.
(4R,6S)-4-(2-carboxyethyl)-1,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4,6-dicarboxylic acid (CAS 120293-52-9) is a chemical compound with the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. IUPAC name: (4R,6S)-4-(2-carboxyethyl)-1,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4,6-dicarboxylic acid. InChIKey: XGCZNSAJOHDWQS-UPONEAKYSA-N.
| Molecular formula | C11H13N3O6 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | (4R,6S)-4-(2-carboxyethyl)-1,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4,6-dicarboxylic acid |
| InChIKey | XGCZNSAJOHDWQS-UPONEAKYSA-N |
| SMILES | C1[C@H](N[C@@](C2=C1NC=N2)(CCC(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)