Products 2248411-87-0
CAS 2248411-87-0 is the registry number for 2-((tert-Butoxycarbonyl)amino)-5-nitronicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropyridine-3-carboxylic acid (CAS 2248411-87-0) is a chemical compound with the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropyridine-3-carboxylic acid. InChIKey: CNTADLAMEPDFLF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O6 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropyridine-3-carboxylic acid |
| InChIKey | CNTADLAMEPDFLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)