Products 1202936-45-5
CAS 1202936-45-5 appears in our catalog under these names: L–Threonine–d2, L-Threonine-2,3-d2, L-Threonine-2,3-d2, 98 atom % D, min 98% Chemical Purity, L-Threonine-2,3-d2, >95% (HPLC), L-Threonine-d2, 99.76%. Offered by: GLPBio, Chemat Brand, CDN, TRC, MedChemExpress. Available pack sizes: 5mg, on request, 0,1g, 0,05g, 10mg, 1mg, 2mg, 25mg.
(2S,3R)-2-amino-2,3-dideuterio-3-hydroxybutanoic acid (CAS 1202936-45-5) is a chemical compound with the molecular formula C4H9NO3 and a molecular weight of 121.13 g/mol. IUPAC name: (2S,3R)-2-amino-2,3-dideuterio-3-hydroxybutanoic acid. InChIKey: AYFVYJQAPQTCCC-JZFQEKCDSA-N.
| Molecular formula | C4H9NO3 |
|---|---|
| Molecular weight | 121.13 g/mol |
| IUPAC name | (2S,3R)-2-amino-2,3-dideuterio-3-hydroxybutanoic acid |
| InChIKey | AYFVYJQAPQTCCC-JZFQEKCDSA-N |
| SMILES | [2H][C@@](C)([C@@]([2H])(C(=O)O)N)O |
Computed by PubChem (NCBI)