Products 1217456-38-6
CAS 1217456-38-6 appears in our catalog under these names: L–Threonine–d5, L-Threonine-d5, 99.9%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg.
(2S,3R)-2-amino-2,3,4,4,4-pentadeuterio-3-hydroxybutanoic acid (CAS 1217456-38-6) is a chemical compound with the molecular formula C4H9NO3 and a molecular weight of 124.15 g/mol. IUPAC name: (2S,3R)-2-amino-2,3,4,4,4-pentadeuterio-3-hydroxybutanoic acid. InChIKey: AYFVYJQAPQTCCC-WKHZCAFQSA-N.
| Molecular formula | C4H9NO3 |
|---|---|
| Molecular weight | 124.15 g/mol |
| IUPAC name | (2S,3R)-2-amino-2,3,4,4,4-pentadeuterio-3-hydroxybutanoic acid |
| InChIKey | AYFVYJQAPQTCCC-WKHZCAFQSA-N |
| SMILES | [2H][C@@](C(=O)O)([C@@]([2H])(C([2H])([2H])[2H])O)N |
Computed by PubChem (NCBI)