CAS 1203-24-3 appears in our catalog under these names: 1-(2-Chlorophenyl)-1h-pyrrole-2,5-dione, 95%, N-(2-Chlorophenyl)maleimide, 97%, 1-(2-Chlorophenyl)-1H-pyrrole-2,5-dione, 98%, 98%, 1-(2-Chloro-phenyl)-pyrrole-2,5-dione. Offered by: Combi-blocks, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 1g, 5g.
1-(2-chlorophenyl)pyrrole-2,5-dione (CAS 1203-24-3) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 1-(2-chlorophenyl)pyrrole-2,5-dione. InChIKey: KPQOXMCRYWDRSB-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-(2-chlorophenyl)pyrrole-2,5-dione |
| InChIKey | KPQOXMCRYWDRSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=O)C=CC2=O)Cl |
Computed by PubChem (NCBI)