Products 1203205-47-3
CAS 1203205-47-3 appears in our catalog under these names: 6-Methyl-2-pyridin-3-ylquinoline-4-carbonyl chloride hydrochloride, 95%, 6-Methyl-2-(pyridin-3-yl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-methyl-2-pyridin-3-ylquinoline-4-carbonyl chloride (CAS 1203205-47-3) is a chemical compound with the molecular formula C16H11ClN2O and a molecular weight of 282.72 g/mol. IUPAC name: 6-methyl-2-pyridin-3-ylquinoline-4-carbonyl chloride. InChIKey: LGIYPSISJHZWDP-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | 6-methyl-2-pyridin-3-ylquinoline-4-carbonyl chloride |
| InChIKey | LGIYPSISJHZWDP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2C(=O)Cl)C3=CN=CC=C3 |
Computed by PubChem (NCBI)