Products 2341841-06-1
CAS 2341841-06-1 is the registry number for KuWal151. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
3-(3-chlorophenyl)-6,7-dihydro-1H-pyrrolo[3,4-g]indol-8-one (CAS 2341841-06-1) is a chemical compound with the molecular formula C16H11ClN2O and a molecular weight of 282.72 g/mol. IUPAC name: 3-(3-chlorophenyl)-6,7-dihydro-1H-pyrrolo[3,4-g]indol-8-one. InChIKey: XZCWNSGWBUAUOO-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-6,7-dihydro-1H-pyrrolo[3,4-g]indol-8-one |
| InChIKey | XZCWNSGWBUAUOO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=C(C=C2)C(=CN3)C4=CC(=CC=C4)Cl)C(=O)N1 |
Computed by PubChem (NCBI)