CAS 1203453-90-0 is the registry number for Bis-desisopropyl Tolterodine. Offered by: TRC. Available pack sizes: 25mg.
2-[(1R)-3-amino-1-phenylpropyl]-4-methylphenol (CAS 1203453-90-0) is a chemical compound with the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. IUPAC name: 2-[(1R)-3-amino-1-phenylpropyl]-4-methylphenol. InChIKey: LZARZVSGZSQUGG-CQSZACIVSA-N.
| Molecular formula | C16H19NO |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | 2-[(1R)-3-amino-1-phenylpropyl]-4-methylphenol |
| InChIKey | LZARZVSGZSQUGG-CQSZACIVSA-N |
| SMILES | CC1=CC(=C(C=C1)O)[C@H](CCN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)