CAS 1203683-65-1 appears in our catalog under these names: Methyl 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-7-carboxylate hydrochloride, 95%, Methyl 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-7-carboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
Methyl 4,4-dimethyl-2,3-dihydro-1H-isoquinoline-7-carboxylate;hydrochloride (CAS 1203683-65-1) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: methyl 4,4-dimethyl-2,3-dihydro-1H-isoquinoline-7-carboxylate;hydrochloride. InChIKey: RRXYRQWMZGBEEM-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | methyl 4,4-dimethyl-2,3-dihydro-1H-isoquinoline-7-carboxylate;hydrochloride |
| InChIKey | RRXYRQWMZGBEEM-UHFFFAOYSA-N |
| SMILES | CC1(CNCC2=C1C=CC(=C2)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)