CAS 1203684-92-7 is the registry number for tert-Butyl 7'-bromo-1'H-spiro(cyclopropane-1,4'-isoquinoline)-2'(3'H)-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 7-bromospiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-carboxylate (CAS 1203684-92-7) is a chemical compound with the molecular formula C16H20BrNO2 and a molecular weight of 338.24 g/mol. IUPAC name: tert-butyl 7-bromospiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-carboxylate. InChIKey: SPKVDLFDICLOLM-UHFFFAOYSA-N.
| Molecular formula | C16H20BrNO2 |
|---|---|
| Molecular weight | 338.24 g/mol |
| IUPAC name | tert-butyl 7-bromospiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-carboxylate |
| InChIKey | SPKVDLFDICLOLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C=CC(=C2)Br)C3(C1)CC3 |
Computed by PubChem (NCBI)