CAS 273727-44-9 appears in our catalog under these names: tert-Butyl 4-(4-bromophenyl)-3,6-dihydropyridine-1(2H)-carboxylate 95+%, TERT-BUTYL 4-(4-BROMOPHENYL)-5,6-DIHYDROPYRIDINE-1(2H)-CARBOXYLATE, 95+%, 95+%, 4-(4-BROMO-PHENYL)-3,6-DIHYDRO-2H-PYRIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER, 95+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 273727-44-9) is a chemical compound with the molecular formula C16H20BrNO2 and a molecular weight of 338.24 g/mol. IUPAC name: tert-butyl 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: UTTKOPGVQIWTCJ-UHFFFAOYSA-N.
| Molecular formula | C16H20BrNO2 |
|---|---|
| Molecular weight | 338.24 g/mol |
| IUPAC name | tert-butyl 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | UTTKOPGVQIWTCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)