CAS 1204-99-5 appears in our catalog under these names: Cycloserine Impurity 7, Cycloserine Diketopiperazine (Mixture of Diastereomers), Cycloserine Diketopiperazine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
(3R,6R)-3,6-bis(aminooxymethyl)piperazine-2,5-dione (CAS 1204-99-5) is a chemical compound with the molecular formula C6H12N4O4 and a molecular weight of 204.18 g/mol. IUPAC name: (3R,6R)-3,6-bis(aminooxymethyl)piperazine-2,5-dione. InChIKey: LRBJUCSMJGKICJ-QWWZWVQMSA-N.
| Molecular formula | C6H12N4O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (3R,6R)-3,6-bis(aminooxymethyl)piperazine-2,5-dione |
| InChIKey | LRBJUCSMJGKICJ-QWWZWVQMSA-N |
| SMILES | C([C@@H]1C(=O)N[C@@H](C(=O)N1)CON)ON |
Computed by PubChem (NCBI)