CAS 16337-02-3 appears in our catalog under these names: Cycloserine Impurity 2, Cycloserine Diketoperazine, Cycloserine Dimer Impurity (Cycloserine Diketoperazine), (3R,6R)-3,6-Bis[(aminooxy)methyl]-2,5-piperazinedione, 98%, 98%, D-Cycloserine dimer, 98%. Offered by: Hubei YoungXin, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg.
(3R,6R)-3,6-bis(aminooxymethyl)piperazine-2,5-dione (CAS 16337-02-3) is a chemical compound with the molecular formula C6H12N4O4 and a molecular weight of 204.18 g/mol. IUPAC name: (3R,6R)-3,6-bis(aminooxymethyl)piperazine-2,5-dione. InChIKey: LRBJUCSMJGKICJ-QWWZWVQMSA-N.
| Molecular formula | C6H12N4O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (3R,6R)-3,6-bis(aminooxymethyl)piperazine-2,5-dione |
| InChIKey | LRBJUCSMJGKICJ-QWWZWVQMSA-N |
| SMILES | C([C@@H]1C(=O)N[C@@H](C(=O)N1)CON)ON |
Computed by PubChem (NCBI)