CAS 1204139-63-8 is the registry number for methyl (2S)-2-(tert-butoxycarbonylamino)-3-(5-hydroxypyrimidin-2-yl)propanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2S)-3-(5-hydroxypyrimidin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1204139-63-8) is a chemical compound with the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. IUPAC name: methyl (2S)-3-(5-hydroxypyrimidin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: VIASGIOMWUPWNW-VIFPVBQESA-N.
| Molecular formula | C13H19N3O5 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | methyl (2S)-3-(5-hydroxypyrimidin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | VIASGIOMWUPWNW-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=NC=C(C=N1)O)C(=O)OC |
Computed by PubChem (NCBI)