Products 76302-70-0

CAS 76302-70-0 is the registry number for Phenazopyridine Impurity 13. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methanol (CAS 76302-70-0) is a chemical compound with the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. IUPAC name: [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methanol. InChIKey: PWAQEHCXAVLWPS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19N3O5
Molecular weight297.31 g/mol
IUPAC name[6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methanol
InChIKeyPWAQEHCXAVLWPS-UHFFFAOYSA-N
SMILESCCC(CC)NC1=C(C=C(C(=C1[N+](=O)[O-])CO)C)[N+](=O)[O-]

Computed by PubChem (NCBI)