CAS 76302-70-0 is the registry number for Phenazopyridine Impurity 13. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methanol (CAS 76302-70-0) is a chemical compound with the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. IUPAC name: [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methanol. InChIKey: PWAQEHCXAVLWPS-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O5 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | [6-methyl-2,4-dinitro-3-(pentan-3-ylamino)phenyl]methanol |
| InChIKey | PWAQEHCXAVLWPS-UHFFFAOYSA-N |
| SMILES | CCC(CC)NC1=C(C=C(C(=C1[N+](=O)[O-])CO)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)