Products 1204234-63-8

CAS 1204234-63-8 is the registry number for 5-((Trifluoromethyl)thio)nicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(trifluoromethylsulfanyl)pyridine-3-carboxylic acid (CAS 1204234-63-8) is a chemical compound with the molecular formula C7H4F3NO2S and a molecular weight of 223.17 g/mol. IUPAC name: 5-(trifluoromethylsulfanyl)pyridine-3-carboxylic acid. InChIKey: LBHFYDUVQBOFIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4F3NO2S
Molecular weight223.17 g/mol
IUPAC name5-(trifluoromethylsulfanyl)pyridine-3-carboxylic acid
InChIKeyLBHFYDUVQBOFIQ-UHFFFAOYSA-N
SMILESC1=C(C=NC=C1SC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)