Products 14371-82-5
CAS 14371-82-5 is the registry number for 2-Nitro-4-(trifluoromethyl)benzenethiol. Offered by: Biosynth. Available pack sizes: 0,5g.
2-nitro-4-(trifluoromethyl)benzenethiol (CAS 14371-82-5) is a chemical compound with the molecular formula C7H4F3NO2S and a molecular weight of 223.17 g/mol. IUPAC name: 2-nitro-4-(trifluoromethyl)benzenethiol. InChIKey: HUJMWBOFGAQSMR-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2S |
|---|---|
| Molecular weight | 223.17 g/mol |
| IUPAC name | 2-nitro-4-(trifluoromethyl)benzenethiol |
| InChIKey | HUJMWBOFGAQSMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])S |
Computed by PubChem (NCBI)