CAS 1204242-96-5 appears in our catalog under these names: tert-Butyl(3-ethylphenoxy)dimethylsilane, 97%, tert-Butyl(3-ethylphenoxy)dimethylsilane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Tert-butyl-(3-ethylphenoxy)-dimethylsilane (CAS 1204242-96-5) is a chemical compound with the molecular formula C14H24OSi and a molecular weight of 236.42 g/mol. IUPAC name: tert-butyl-(3-ethylphenoxy)-dimethylsilane. InChIKey: FPVVLQRSBAXJSE-UHFFFAOYSA-N.
| Molecular formula | C14H24OSi |
|---|---|
| Molecular weight | 236.42 g/mol |
| IUPAC name | tert-butyl-(3-ethylphenoxy)-dimethylsilane |
| InChIKey | FPVVLQRSBAXJSE-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)