Products 229177-48-4
CAS 229177-48-4 is the registry number for tert-Butyl(3,4-dimethylphenoxy)dimethylsilane, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl-(3,4-dimethylphenoxy)-dimethylsilane (CAS 229177-48-4) is a chemical compound with the molecular formula C14H24OSi and a molecular weight of 236.42 g/mol. IUPAC name: tert-butyl-(3,4-dimethylphenoxy)-dimethylsilane. InChIKey: WYRIYPXBLBRJRJ-UHFFFAOYSA-N.
| Molecular formula | C14H24OSi |
|---|---|
| Molecular weight | 236.42 g/mol |
| IUPAC name | tert-butyl-(3,4-dimethylphenoxy)-dimethylsilane |
| InChIKey | WYRIYPXBLBRJRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O[Si](C)(C)C(C)(C)C)C |
Computed by PubChem (NCBI)