CAS 1204295-66-8 is the registry number for 4-(1,1-Difluoroethyl)-1,2-dimethylbenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1-difluoroethyl)-1,2-dimethylbenzene (CAS 1204295-66-8) is a chemical compound with the molecular formula C10H12F2 and a molecular weight of 170.20 g/mol. IUPAC name: 4-(1,1-difluoroethyl)-1,2-dimethylbenzene. InChIKey: SVLMKTVZLOGGGP-UHFFFAOYSA-N.
| Molecular formula | C10H12F2 |
|---|---|
| Molecular weight | 170.20 g/mol |
| IUPAC name | 4-(1,1-difluoroethyl)-1,2-dimethylbenzene |
| InChIKey | SVLMKTVZLOGGGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(F)F)C |
Computed by PubChem (NCBI)