CAS 1941239-56-0 is the registry number for 1-(1,1-difluoroethyl)-3,5-dimethylbenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-difluoroethyl)-3,5-dimethylbenzene (CAS 1941239-56-0) is a chemical compound with the molecular formula C10H12F2 and a molecular weight of 170.20 g/mol. IUPAC name: 1-(1,1-difluoroethyl)-3,5-dimethylbenzene. InChIKey: ALAUZCMZMZBZFX-UHFFFAOYSA-N.
| Molecular formula | C10H12F2 |
|---|---|
| Molecular weight | 170.20 g/mol |
| IUPAC name | 1-(1,1-difluoroethyl)-3,5-dimethylbenzene |
| InChIKey | ALAUZCMZMZBZFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C)(F)F)C |
Computed by PubChem (NCBI)