Products 1204333-57-2

CAS 1204333-57-2 appears in our catalog under these names: 1,5-Dimethylpyrazole-4-boronic acid, 96%, (1,5–Dimethyl–1H–pyrazol–4–yl)boronic acid, (1,5-Dimethyl-1H-pyrazol-4-yl)boronic acid 98%, (1,5-Dimethyl-1H-pyrazol-4-yl)boronic acid, 97%, 97%, (1,5-Dimethyl-1H-pyrazol-4-yl)boronic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

(1,5-dimethylpyrazol-4-yl)boronic acid (CAS 1204333-57-2) is a chemical compound with the molecular formula C5H9BN2O2 and a molecular weight of 139.95 g/mol. IUPAC name: (1,5-dimethylpyrazol-4-yl)boronic acid. InChIKey: NAYVNBPKYJFKQA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9BN2O2
Molecular weight139.95 g/mol
IUPAC name(1,5-dimethylpyrazol-4-yl)boronic acid
InChIKeyNAYVNBPKYJFKQA-UHFFFAOYSA-N
SMILESB(C1=C(N(N=C1)C)C)(O)O

Computed by PubChem (NCBI)