Products 847818-68-2

CAS 847818-68-2 appears in our catalog under these names: (1,3–Dimethyl–1H–pyrazol–5–yl)boronic acid, (1,3-Dimethyl-1H-pyrazol-5-yl)boronic acid, 95%, 95%, (1,3-Dimethyl-1H-pyrazol-5-yl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.

Structural formula: {0} (CAS {1})

(1,3-dimethylpyrazol-5-yl)boronic acid (CAS 847818-68-2) is a chemical compound with the molecular formula C5H9BN2O2 and a molecular weight of 139.95 g/mol. IUPAC name: (1,3-dimethylpyrazol-5-yl)boronic acid. InChIKey: RAAWPADCPXAWSK-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9BN2O2
Molecular weight139.95 g/mol
IUPAC name(1,3-dimethylpyrazol-5-yl)boronic acid
InChIKeyRAAWPADCPXAWSK-UHFFFAOYSA-N
SMILESB(C1=CC(=NN1C)C)(O)O

Computed by PubChem (NCBI)