Products 1204408-27-4
CAS 1204408-27-4 is the registry number for HD-800. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-methoxyphenyl)-N,5-dimethylfuro[2,3-d]pyrimidin-4-amine (CAS 1204408-27-4) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: N-(4-methoxyphenyl)-N,5-dimethylfuro[2,3-d]pyrimidin-4-amine. InChIKey: UVZUIESPIIIPQW-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-N,5-dimethylfuro[2,3-d]pyrimidin-4-amine |
| InChIKey | UVZUIESPIIIPQW-UHFFFAOYSA-N |
| SMILES | CC1=COC2=NC=NC(=C12)N(C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)