CAS 1204518-38-6 is the registry number for Des-Methylcarbonate Hydroxy Flometoquin, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
2-ethyl-3,7-dimethyl-6-[4-(trifluoromethoxy)phenoxy]-1H-quinolin-4-one (CAS 1204518-38-6) is a chemical compound with the molecular formula C20H18F3NO3 and a molecular weight of 377.4 g/mol. IUPAC name: 2-ethyl-3,7-dimethyl-6-[4-(trifluoromethoxy)phenoxy]-1H-quinolin-4-one. InChIKey: ASLRWALDQPYSPM-UHFFFAOYSA-N.
| Molecular formula | C20H18F3NO3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-ethyl-3,7-dimethyl-6-[4-(trifluoromethoxy)phenoxy]-1H-quinolin-4-one |
| InChIKey | ASLRWALDQPYSPM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=O)C2=C(N1)C=C(C(=C2)OC3=CC=C(C=C3)OC(F)(F)F)C)C |
Computed by PubChem (NCBI)