CAS 182439-11-8 appears in our catalog under these names: Lomitapide M3, 9-(((2,2,2-Trifluoroethyl)amino)carbonyl)-9H-fluorene-9-butanoic Acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5g, 1000mg, 500mg.
4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butanoic acid (CAS 182439-11-8) is a chemical compound with the molecular formula C20H18F3NO3 and a molecular weight of 377.4 g/mol. IUPAC name: 4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butanoic acid. InChIKey: OMOCFKYWOGDCTG-UHFFFAOYSA-N.
| Molecular formula | C20H18F3NO3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butanoic acid |
| InChIKey | OMOCFKYWOGDCTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(CCCC(=O)O)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)