Products 1204581-50-9
CAS 1204581-50-9 appears in our catalog under these names: Ramelteon Impurity E, Ramelteon Impurity 10, 4-Hydroxy Ramelteon, Ramelteon Impurity 21. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-[2-[(8S)-4-hydroxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 1204581-50-9) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: N-[2-[(8S)-4-hydroxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: FRMQCJSLRUTQQH-JTQLQIEISA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | N-[2-[(8S)-4-hydroxy-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | FRMQCJSLRUTQQH-JTQLQIEISA-N |
| SMILES | CCC(=O)NCC[C@@H]1CCC2=CC(=C3C(=C12)CCO3)O |
Computed by PubChem (NCBI)