Products 1204810-71-8
CAS 1204810-71-8 is the registry number for 3-Chloro-8-bromo-4-hydroxyquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-bromo-3-chloro-1H-quinolin-4-one (CAS 1204810-71-8) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 8-bromo-3-chloro-1H-quinolin-4-one. InChIKey: JCXOKHKVTKLUON-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 8-bromo-3-chloro-1H-quinolin-4-one |
| InChIKey | JCXOKHKVTKLUON-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C(C2=O)Cl |
Computed by PubChem (NCBI)