CAS 1204811-78-8 is the registry number for 3-Bromo-4-chloro-7,8-difluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-chloro-7,8-difluoroquinoline (CAS 1204811-78-8) is a chemical compound with the molecular formula C9H3BrClF2N and a molecular weight of 278.48 g/mol. IUPAC name: 3-bromo-4-chloro-7,8-difluoroquinoline. InChIKey: XFLLNZKEVRGMON-UHFFFAOYSA-N.
| Molecular formula | C9H3BrClF2N |
|---|---|
| Molecular weight | 278.48 g/mol |
| IUPAC name | 3-bromo-4-chloro-7,8-difluoroquinoline |
| InChIKey | XFLLNZKEVRGMON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C(=C21)Cl)Br)F)F |
Computed by PubChem (NCBI)