CAS 2920713-03-5 is the registry number for 4-Bromo-5-chloro-7,8-difluoroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-chloro-7,8-difluoroisoquinoline (CAS 2920713-03-5) is a chemical compound with the molecular formula C9H3BrClF2N and a molecular weight of 278.48 g/mol. IUPAC name: 4-bromo-5-chloro-7,8-difluoroisoquinoline. InChIKey: LLGQJCZXNGWXAJ-UHFFFAOYSA-N.
| Molecular formula | C9H3BrClF2N |
|---|---|
| Molecular weight | 278.48 g/mol |
| IUPAC name | 4-bromo-5-chloro-7,8-difluoroisoquinoline |
| InChIKey | LLGQJCZXNGWXAJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C=NC=C(C2=C1Cl)Br)F)F |
Computed by PubChem (NCBI)