CAS 120512-03-0 appears in our catalog under these names: Anastrozole Impurity 7, Anastrozole Impurity 14, Anastrozole Impurity 15, Anastrozole Monoamide, >95% (HPLC), 2-(3-(2-Cyanopropan-2-yl)-5-(1H-1,2,4-triazol-1-ylmethyl)phenyl)-2-methylpropanamide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanamide (CAS 120512-03-0) is a chemical compound with the molecular formula C17H21N5O and a molecular weight of 311.4 g/mol. IUPAC name: 2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanamide. InChIKey: PTMXOEDIIUCXST-UHFFFAOYSA-N.
| Molecular formula | C17H21N5O |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanamide |
| InChIKey | PTMXOEDIIUCXST-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(C)C(=O)N |
Computed by PubChem (NCBI)