CAS 2469243-05-6 is the registry number for Anastrozole Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanamide (CAS 2469243-05-6) is a chemical compound with the molecular formula C17H21N5O and a molecular weight of 311.4 g/mol. IUPAC name: 2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanamide. InChIKey: QHUSIGNGMIOCMA-UHFFFAOYSA-N.
| Molecular formula | C17H21N5O |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanamide |
| InChIKey | QHUSIGNGMIOCMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NN=C2)C(C)(C)C(=O)N |
Computed by PubChem (NCBI)