CAS 120512-38-1 appears in our catalog under these names: 2-(3-(1-Cyanoethyl)-5-methylphenyl)-2-methylpropanenitrile, 95%, Anastrozole Impurity 26, alpha,alpha,alpha',5-Tetramethyl-1,3-benzenediacetonitrile, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
2-[3-(1-cyanoethyl)-5-methylphenyl]-2-methylpropanenitrile (CAS 120512-38-1) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 2-[3-(1-cyanoethyl)-5-methylphenyl]-2-methylpropanenitrile. InChIKey: WYIZCUPTSQDNTC-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 2-[3-(1-cyanoethyl)-5-methylphenyl]-2-methylpropanenitrile |
| InChIKey | WYIZCUPTSQDNTC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)C#N)C(C)C#N |
Computed by PubChem (NCBI)