CAS 120537-28-2 is the registry number for Apigenin-4'-O-sulfate Potassium Salt. Offered by: TRC. Available pack sizes: 25mg.
Potassium [4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl] sulfate (CAS 120537-28-2) is a chemical compound with the molecular formula C15H9KO8S and a molecular weight of 388.4 g/mol. IUPAC name: potassium [4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl] sulfate. InChIKey: NWZRMXXKONZAQD-UHFFFAOYSA-M.
| Molecular formula | C15H9KO8S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | potassium [4-(5,7-dihydroxy-4-oxochromen-2-yl)phenyl] sulfate |
| InChIKey | NWZRMXXKONZAQD-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)