CAS 120562-19-8 appears in our catalog under these names: Apigenin-7-O-sulfate Potassium Salt, >95% (HPLC), Apigenin-7-O-sulfate (potassium), 99.9%. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 25mg, 1 mg, 5 mg.
Potassium [5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] sulfate (CAS 120562-19-8) is a chemical compound with the molecular formula C15H9KO8S and a molecular weight of 388.4 g/mol. IUPAC name: potassium [5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] sulfate. InChIKey: GSJHDZLRMIJSLH-UHFFFAOYSA-M.
| Molecular formula | C15H9KO8S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | potassium [5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] sulfate |
| InChIKey | GSJHDZLRMIJSLH-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)OS(=O)(=O)[O-])O)O.[K+] |
Computed by PubChem (NCBI)