Products 1205548-00-0
CAS 1205548-00-0 is the registry number for 2-(4-(Dimethylamino)phenyl)-7,8-dihydroxy-4H-chromen-4-one hydrobromide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one;hydrobromide (CAS 1205548-00-0) is a chemical compound with the molecular formula C17H16BrNO4 and a molecular weight of 378.2 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one;hydrobromide. InChIKey: FKDWSHWAECFQIG-UHFFFAOYSA-N.
| Molecular formula | C17H16BrNO4 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-7,8-dihydroxychromen-4-one;hydrobromide |
| InChIKey | FKDWSHWAECFQIG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3)O)O.Br |
Computed by PubChem (NCBI)