CAS 158069-49-9 is the registry number for Z-Phe(4-Br)-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-(4-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 158069-49-9) is a chemical compound with the molecular formula C17H16BrNO4 and a molecular weight of 378.2 g/mol. IUPAC name: (2S)-3-(4-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: PEPFGOGDPWWISR-HNNXBMFYSA-N.
| Molecular formula | C17H16BrNO4 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | (2S)-3-(4-bromophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | PEPFGOGDPWWISR-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)