CAS 120568-08-3 is the registry number for 4-(Trifluoromethyl)isoquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(trifluoromethyl)isoquinoline (CAS 120568-08-3) is a chemical compound with the molecular formula C10H6F3N and a molecular weight of 197.16 g/mol. IUPAC name: 4-(trifluoromethyl)isoquinoline. InChIKey: QWQQKJDMJBMSFQ-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 4-(trifluoromethyl)isoquinoline |
| InChIKey | QWQQKJDMJBMSFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC=C2C(F)(F)F |
Computed by PubChem (NCBI)