CAS 26053-68-9 appears in our catalog under these names: 1-(Trifluoromethyl)isoquinoline, 95+%, 1-(Trifluoromethyl)isoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(trifluoromethyl)isoquinoline (CAS 26053-68-9) is a chemical compound with the molecular formula C10H6F3N and a molecular weight of 197.16 g/mol. IUPAC name: 1-(trifluoromethyl)isoquinoline. InChIKey: YMIKANRMRRBHTB-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 1-(trifluoromethyl)isoquinoline |
| InChIKey | YMIKANRMRRBHTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2C(F)(F)F |
Computed by PubChem (NCBI)