Products 1205687-48-4
CAS 1205687-48-4 appears in our catalog under these names: 1，3–Dihydroxy–2，4–diprenylacridone, 1,3-Dihydroxy-2,4-diprenylacridone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
1,3-dihydroxy-2,4-bis(3-methylbut-2-enyl)-10H-acridin-9-one (CAS 1205687-48-4) is a chemical compound with the molecular formula C23H25NO3 and a molecular weight of 363.4 g/mol. IUPAC name: 1,3-dihydroxy-2,4-bis(3-methylbut-2-enyl)-10H-acridin-9-one. InChIKey: YJXSGTZSGZPDFU-UHFFFAOYSA-N.
| Molecular formula | C23H25NO3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 1,3-dihydroxy-2,4-bis(3-methylbut-2-enyl)-10H-acridin-9-one |
| InChIKey | YJXSGTZSGZPDFU-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C(=C1O)CC=C(C)C)O)C(=O)C3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)
Synonyms:
1,3-Dihydroxy-2,4-diprenylacridone, orb1680571