Products 1954693-22-1
CAS 1954693-22-1 is the registry number for KV 37. Offered by: Biosynth. Available pack sizes: 10mg.
(E)-3-[4-(3-methylbut-2-enyl)-3-(3-phenylpropanoylamino)phenyl]prop-2-enoic acid (CAS 1954693-22-1) is a chemical compound with the molecular formula C23H25NO3 and a molecular weight of 363.4 g/mol. IUPAC name: (E)-3-[4-(3-methylbut-2-enyl)-3-(3-phenylpropanoylamino)phenyl]prop-2-enoic acid. InChIKey: SMYHHZFAWOLAAX-RVDMUPIBSA-N.
| Molecular formula | C23H25NO3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (E)-3-[4-(3-methylbut-2-enyl)-3-(3-phenylpropanoylamino)phenyl]prop-2-enoic acid |
| InChIKey | SMYHHZFAWOLAAX-RVDMUPIBSA-N |
| SMILES | CC(=CCC1=C(C=C(C=C1)/C=C/C(=O)O)NC(=O)CCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)