Products 1206228-60-5

CAS 1206228-60-5 is the registry number for 3,3-Dimethylindoline-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid (CAS 1206228-60-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid. InChIKey: BQNJBZIYSQAEEW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC name3,3-dimethyl-1,2-dihydroindole-6-carboxylic acid
InChIKeyBQNJBZIYSQAEEW-UHFFFAOYSA-N
SMILESCC1(CNC2=C1C=CC(=C2)C(=O)O)C

Computed by PubChem (NCBI)