Products 120650-90-0
CAS 120650-90-0 is the registry number for (E)-2-Cyano-3-(dimethylamino)but-2-enamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(E)-2-cyano-3-(dimethylamino)but-2-enamide (CAS 120650-90-0) is a chemical compound with the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. IUPAC name: (E)-2-cyano-3-(dimethylamino)but-2-enamide. InChIKey: CPNKUDCDGKOECR-AATRIKPKSA-N.
| Molecular formula | C7H11N3O |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | (E)-2-cyano-3-(dimethylamino)but-2-enamide |
| InChIKey | CPNKUDCDGKOECR-AATRIKPKSA-N |
| SMILES | C/C(=C(/C#N)\C(=O)N)/N(C)C |
Computed by PubChem (NCBI)