CAS 1206626-95-0 appears in our catalog under these names: 10-Phenyl-10H,10'H-spiro[acridine-9,9'-anthracen]-10'-one, 97%, Poly(2,5-bis(3-sulfonatopropoxy)-1,4-phenylene, disodium salt-alt-1,4-phenylene), ACRSA, 10-PHENYL-10H,10'H-SPIRO[ACRIDINE-9,9'-&. Offered by: Chemat Brand, Lumtec, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 1g, 250MG.
10-phenylspiro[acridine-9,10'-anthracene]-9'-one (CAS 1206626-95-0) is a chemical compound with the molecular formula C32H21NO and a molecular weight of 435.5 g/mol. IUPAC name: 10-phenylspiro[acridine-9,10'-anthracene]-9'-one. InChIKey: ASXSTQHYXCIZRV-UHFFFAOYSA-N.
| Molecular formula | C32H21NO |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | 10-phenylspiro[acridine-9,10'-anthracene]-9'-one |
| InChIKey | ASXSTQHYXCIZRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C4(C5=CC=CC=C5C(=O)C6=CC=CC=C64)C7=CC=CC=C72 |
Computed by PubChem (NCBI)