CAS 2478532-03-3 is the registry number for N-(4-(Dibenzo[b,d]furan-4-yl)phenyl)phenanthren-9-amine, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 250mg.
N-(4-dibenzofuran-4-ylphenyl)phenanthren-9-amine (CAS 2478532-03-3) is a chemical compound with the molecular formula C32H21NO and a molecular weight of 435.5 g/mol. IUPAC name: N-(4-dibenzofuran-4-ylphenyl)phenanthren-9-amine. InChIKey: HLFZMHDSWCOENH-UHFFFAOYSA-N.
| Molecular formula | C32H21NO |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | N-(4-dibenzofuran-4-ylphenyl)phenanthren-9-amine |
| InChIKey | HLFZMHDSWCOENH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)NC4=CC=C(C=C4)C5=CC=CC6=C5OC7=CC=CC=C67 |
Computed by PubChem (NCBI)