CAS 120667-17-6 is the registry number for 4-Phosphonomethyl-DL-Phenylalanine. Offered by: Creative Peptides. Available pack sizes: on request.
4-(phosphonomethyl)phenylalanine is a phenylalanine derivative that is phenylalanine substituted by a phosphonomethyl group at position 4. It is a phenylalanine derivative, a phosphoamino acid, an aromatic amino acid and a non-proteinogenic alpha-amino acid.
Source: ChEBI
| Molecular formula | C10H14NO5P |
|---|---|
| Molecular weight | 259.20 g/mol |
| IUPAC name | 2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid |
| InChIKey | SAQLLHDEEMZENJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)CP(=O)(O)O |
Computed by PubChem (NCBI)