CAS 140151-39-9 is the registry number for N-((3-(Phosphonomethyl)phenyl)methyl)-glycine. Offered by: TRC. Available pack sizes: 250mg.
2-[[3-(phosphonomethyl)phenyl]methylamino]acetic acid (CAS 140151-39-9) is a chemical compound with the molecular formula C10H14NO5P and a molecular weight of 259.20 g/mol. IUPAC name: 2-[[3-(phosphonomethyl)phenyl]methylamino]acetic acid. InChIKey: IBYVSIQQZDWOEL-UHFFFAOYSA-N.
| Molecular formula | C10H14NO5P |
|---|---|
| Molecular weight | 259.20 g/mol |
| IUPAC name | 2-[[3-(phosphonomethyl)phenyl]methylamino]acetic acid |
| InChIKey | IBYVSIQQZDWOEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CP(=O)(O)O)CNCC(=O)O |
Computed by PubChem (NCBI)